C16H25I2N3O2 — CID 109454443
N-ethyl-N'-(2-hydroxyethyl)-4-(2-iodophenoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109454443) has the molecular formula C16H25I2N3O2 and a molecular weight of 545.20 g/mol. Its IUPAC name is N-ethyl-N'-(2-hydroxyethyl)-4-(2-iodophenoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(2-hydroxyethyl)-4-(2-iodophenoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109454443 |
| Molecular Formula | C16H25I2N3O2 |
| Molecular Weight | 545.20 g/mol |
| Exact Mass | 545.00 |
| IUPAC Name | N-ethyl-N'-(2-hydroxyethyl)-4-(2-iodophenoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCO)N1CCC(Oc2ccccc2I)CC1.I |
| InChI | InChI=1S/C16H24IN3O2.HI/c1-2-18-16(19-9-12-21)20-10-7-13(8-11-20)22-15-6-4-3-5-14(15)17;/h3-6,13,21H,2,7-12H2,1H3,(H,18,19);1H |
| InChIKey | VVWALQDXDGSQTD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|