C17H24IN3O — CID 109454398
N-(cyclopropylmethyl)-4-(2-iodophenoxy)-N'-methylpiperidine-1-carboximidamide (PubChem CID 109454398) has the molecular formula C17H24IN3O and a molecular weight of 413.30 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-(2-iodophenoxy)-N'-methylpiperidine-1-carboximidamide.
| Compound Name | N-(cyclopropylmethyl)-4-(2-iodophenoxy)-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109454398 |
| Molecular Formula | C17H24IN3O |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-(cyclopropylmethyl)-4-(2-iodophenoxy)-N'-methylpiperidine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CC1)N1CCC(Oc2ccccc2I)CC1 |
| InChI | InChI=1S/C17H24IN3O/c1-19-17(20-12-13-6-7-13)21-10-8-14(9-11-21)22-16-5-3-2-4-15(16)18/h2-5,13-14H,6-12H2,1H3,(H,19,20) |
| InChIKey | BRUSEXKEKXWAAP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|