C22H33IN4S — CID 109457925
1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-(2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 109457925) has the molecular formula C22H33IN4S and a molecular weight of 512.51 g/mol. Its IUPAC name is 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-(2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-(2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109457925 |
| Molecular Formula | C22H33IN4S |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-(2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)c1cccs1)NC1CCN(Cc2ccccc2)C(C)C1.I |
| InChI | InChI=1S/C22H32N4S.HI/c1-17(21-10-7-13-27-21)15-24-22(23-3)25-20-11-12-26(18(2)14-20)16-19-8-5-4-6-9-19;/h4-10,13,17-18,20H,11-12,14-16H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | FXOKIQXZNFKMHY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|