C21H31N5O2S2 — CID 109459008
1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-[2-(thiophen-2-ylsulfonylamino)ethyl]guanidine (PubChem CID 109459008) has the molecular formula C21H31N5O2S2 and a molecular weight of 449.65 g/mol. Its IUPAC name is 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-[2-(thiophen-2-ylsulfonylamino)ethyl]guanidine.
| Compound Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-[2-(thiophen-2-ylsulfonylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 109459008 |
| Molecular Formula | C21H31N5O2S2 |
| Molecular Weight | 449.65 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-[2-(thiophen-2-ylsulfonylamino)ethyl]guanidine |
| SMILES | C/N=C(\NCCNS(=O)(=O)c1cccs1)NC1CCN(Cc2ccccc2)C(C)C1 |
| InChI | InChI=1S/C21H31N5O2S2/c1-17-15-19(10-13-26(17)16-18-7-4-3-5-8-18)25-21(22-2)23-11-12-24-30(27,28)20-9-6-14-29-20/h3-9,14,17,19,24H,10-13,15-16H2,1-2H3,(H2,22,23,25) |
| InChIKey | ODRAMOCCPXJDBE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.65 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|