C21H32IN5S2 — CID 109457937
1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine;hydroiodide (PubChem CID 109457937) has the molecular formula C21H32IN5S2 and a molecular weight of 545.56 g/mol. Its IUPAC name is 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109457937 |
| Molecular Formula | C21H32IN5S2 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCSc1nccs1)NC1CCN(Cc2ccccc2)C(C)C1.I |
| InChI | InChI=1S/C21H31N5S2.HI/c1-17-15-19(9-12-26(17)16-18-7-4-3-5-8-18)25-20(22-2)23-10-6-13-27-21-24-11-14-28-21;/h3-5,7-8,11,14,17,19H,6,9-10,12-13,15-16H2,1-2H3,(H2,22,23,25);1H |
| InChIKey | TTYIFZHFMWEALX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|