C16H29N5S2 — CID 111830421
2-methyl-1-(1-propan-2-ylpiperidin-4-yl)-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine (PubChem CID 111830421) has the molecular formula C16H29N5S2 and a molecular weight of 355.58 g/mol. Its IUPAC name is 2-methyl-1-(1-propan-2-ylpiperidin-4-yl)-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine.
| Compound Name | 2-methyl-1-(1-propan-2-ylpiperidin-4-yl)-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
|---|---|
| PubChem CID | 111830421 |
| Molecular Formula | C16H29N5S2 |
| Molecular Weight | 355.58 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-methyl-1-(1-propan-2-ylpiperidin-4-yl)-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
| SMILES | C/N=C(\NCCCSc1nccs1)NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C16H29N5S2/c1-13(2)21-9-5-14(6-10-21)20-15(17-3)18-7-4-11-22-16-19-8-12-23-16/h8,12-14H,4-7,9-11H2,1-3H3,(H2,17,18,20) |
| InChIKey | BLNVGFXYMLZEIG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|