C16H27N5O2S2 — CID 111830691
ethyl 4-[[N'-methyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111830691) has the molecular formula C16H27N5O2S2 and a molecular weight of 385.56 g/mol. Its IUPAC name is ethyl 4-[[N'-methyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-methyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111830691 |
| Molecular Formula | C16H27N5O2S2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | ethyl 4-[[N'-methyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCCSc2nccs2)CC1 |
| InChI | InChI=1S/C16H27N5O2S2/c1-3-23-16(22)21-9-5-13(6-10-21)20-14(17-2)18-7-4-11-24-15-19-8-12-25-15/h8,12-13H,3-7,9-11H2,1-2H3,(H2,17,18,20) |
| InChIKey | XCALSIDVTBUWNA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|