C27H39N5O — CID 109458664
1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]guanidine (PubChem CID 109458664) has the molecular formula C27H39N5O and a molecular weight of 449.64 g/mol. Its IUPAC name is 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109458664 |
| Molecular Formula | C27H39N5O |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.32 |
| IUPAC Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1cccc(CN2CCOCC2)c1)NC1CCN(Cc2ccccc2)C(C)C1 |
| InChI | InChI=1S/C27H39N5O/c1-22-17-26(11-12-32(22)21-23-7-4-3-5-8-23)30-27(28-2)29-19-24-9-6-10-25(18-24)20-31-13-15-33-16-14-31/h3-10,18,22,26H,11-17,19-21H2,1-2H3,(H2,28,29,30) |
| InChIKey | ROCWYHVLDUCXKI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|