C23H31N5O — CID 109458016
4-[[[N-(1-benzyl-2-methylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]methyl]benzamide (PubChem CID 109458016) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is 4-[[[N-(1-benzyl-2-methylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]methyl]benzamide.
| Compound Name | 4-[[[N-(1-benzyl-2-methylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 109458016 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 4-[[[N-(1-benzyl-2-methylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1ccc(C(N)=O)cc1)NC1CCN(Cc2ccccc2)C(C)C1 |
| InChI | InChI=1S/C23H31N5O/c1-17-14-21(12-13-28(17)16-19-6-4-3-5-7-19)27-23(25-2)26-15-18-8-10-20(11-9-18)22(24)29/h3-11,17,21H,12-16H2,1-2H3,(H2,24,29)(H2,25,26,27) |
| InChIKey | MCYCYOQCYHPUML-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|