C22H33N7 — CID 109457308
1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 109457308) has the molecular formula C22H33N7 and a molecular weight of 395.56 g/mol. Its IUPAC name is 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109457308 |
| Molecular Formula | C22H33N7 |
| Molecular Weight | 395.56 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1nnc2n1CCCC2)NC1CCN(Cc2ccccc2)C(C)C1 |
| InChI | InChI=1S/C22H33N7/c1-17-14-19(11-13-28(17)16-18-8-4-3-5-9-18)25-22(23-2)24-15-21-27-26-20-10-6-7-12-29(20)21/h3-5,8-9,17,19H,6-7,10-16H2,1-2H3,(H2,23,24,25) |
| InChIKey | WHUUFWRKFBNRNH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|