C21H31N5S — CID 109458788
1-(1-benzyl-2-methylpiperidin-4-yl)-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylguanidine (PubChem CID 109458788) has the molecular formula C21H31N5S and a molecular weight of 385.58 g/mol. Its IUPAC name is 1-(1-benzyl-2-methylpiperidin-4-yl)-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylguanidine.
| Compound Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109458788 |
| Molecular Formula | C21H31N5S |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1sc(C)nc1C)NC1CCN(Cc2ccccc2)C(C)C1 |
| InChI | InChI=1S/C21H31N5S/c1-15-12-19(10-11-26(15)14-18-8-6-5-7-9-18)25-21(22-4)23-13-20-16(2)24-17(3)27-20/h5-9,15,19H,10-14H2,1-4H3,(H2,22,23,25) |
| InChIKey | HTLTUCPGNWFIOC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|