C24H34FIN4O — CID 109458785
1-(1-benzyl-2-methylpiperidin-4-yl)-3-[(4-ethoxy-3-fluorophenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 109458785) has the molecular formula C24H34FIN4O and a molecular weight of 540.47 g/mol. Its IUPAC name is 1-(1-benzyl-2-methylpiperidin-4-yl)-3-[(4-ethoxy-3-fluorophenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-3-[(4-ethoxy-3-fluorophenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109458785 |
| Molecular Formula | C24H34FIN4O |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-3-[(4-ethoxy-3-fluorophenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOc1ccc(CN/C(=N\C)NC2CCN(Cc3ccccc3)C(C)C2)cc1F.I |
| InChI | InChI=1S/C24H33FN4O.HI/c1-4-30-23-11-10-20(15-22(23)25)16-27-24(26-3)28-21-12-13-29(18(2)14-21)17-19-8-6-5-7-9-19;/h5-11,15,18,21H,4,12-14,16-17H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | VSMCTTDQHWACNB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|