C28H40N4O — CID 109459204
1-(1-benzyl-2-methylpiperidin-4-yl)-3-ethyl-2-[(4-phenyloxan-4-yl)methyl]guanidine (PubChem CID 109459204) has the molecular formula C28H40N4O and a molecular weight of 448.66 g/mol. Its IUPAC name is 1-(1-benzyl-2-methylpiperidin-4-yl)-3-ethyl-2-[(4-phenyloxan-4-yl)methyl]guanidine.
| Compound Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-3-ethyl-2-[(4-phenyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109459204 |
| Molecular Formula | C28H40N4O |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-3-ethyl-2-[(4-phenyloxan-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CCOCC1)NC1CCN(Cc2ccccc2)C(C)C1 |
| InChI | InChI=1S/C28H40N4O/c1-3-29-27(30-22-28(15-18-33-19-16-28)25-12-8-5-9-13-25)31-26-14-17-32(23(2)20-26)21-24-10-6-4-7-11-24/h4-13,23,26H,3,14-22H2,1-2H3,(H2,29,30,31) |
| InChIKey | IIYPRZMVAJDWDV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|