C25H39IN4O — CID 109459267
1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide (PubChem CID 109459267) has the molecular formula C25H39IN4O and a molecular weight of 538.52 g/mol. Its IUPAC name is 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide.
| Compound Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109459267 |
| Molecular Formula | C25H39IN4O |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 1-(1-benzyl-2-methylpiperidin-4-yl)-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
| SMILES | C/N=C(\NC1CCN(Cc2ccccc2)C(C)C1)NC1C2CCOC2C12CCCC2.I |
| InChI | InChI=1S/C25H38N4O.HI/c1-18-16-20(10-14-29(18)17-19-8-4-3-5-9-19)27-24(26-2)28-22-21-11-15-30-23(21)25(22)12-6-7-13-25;/h3-5,8-9,18,20-23H,6-7,10-17H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | XULJNBYSZQHHFO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|