C14H25NO3Si — CID 10945963
(8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-1,3,6,7,8,8a-hexahydroindolizine-2,5-dione (PubChem CID 10945963) has the molecular formula C14H25NO3Si and a molecular weight of 283.44 g/mol. Its IUPAC name is (8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-1,3,6,7,8,8a-hexahydroindolizine-2,5-dione.
| Compound Name | (8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-1,3,6,7,8,8a-hexahydroindolizine-2,5-dione |
|---|---|
| PubChem CID | 10945963 |
| Molecular Formula | C14H25NO3Si |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-1,3,6,7,8,8a-hexahydroindolizine-2,5-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC(=O)N2CC(=O)C[C@H]12 |
| InChI | InChI=1S/C14H25NO3Si/c1-14(2,3)19(4,5)18-12-6-7-13(17)15-9-10(16)8-11(12)15/h11-12H,6-9H2,1-5H3/t11-,12+/m1/s1 |
| InChIKey | YKANRKNTEWSXIP-NEPJUHHUSA-N |
| XLogP | 2.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|