C12H23NO2Si — CID 10922710
(8S,8aS)-8-methyl-8-trimethylsilyloxy-1,2,3,6,7,8a-hexahydroindolizin-5-one (PubChem CID 10922710) has the molecular formula C12H23NO2Si and a molecular weight of 241.41 g/mol. Its IUPAC name is (8S,8aS)-8-methyl-8-trimethylsilyloxy-1,2,3,6,7,8a-hexahydroindolizin-5-one.
| Compound Name | (8S,8aS)-8-methyl-8-trimethylsilyloxy-1,2,3,6,7,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 10922710 |
| Molecular Formula | C12H23NO2Si |
| Molecular Weight | 241.41 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (8S,8aS)-8-methyl-8-trimethylsilyloxy-1,2,3,6,7,8a-hexahydroindolizin-5-one |
| SMILES | C[C@]1(O[Si](C)(C)C)CCC(=O)N2CCC[C@H]21 |
| InChI | InChI=1S/C12H23NO2Si/c1-12(15-16(2,3)4)8-7-11(14)13-9-5-6-10(12)13/h10H,5-9H2,1-4H3/t10-,12-/m0/s1 |
| InChIKey | ZJUVJYBGTRNTDP-JQWIXIFHSA-N |
| XLogP | 2.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|