C16H32NO5PSi — CID 11111626
(8R,8aS)-6-diethoxyphosphoryl-8-methyl-8-trimethylsilyloxy-1,2,3,6,7,8a-hexahydroindolizin-5-one (PubChem CID 11111626) has the molecular formula C16H32NO5PSi and a molecular weight of 377.49 g/mol. Its IUPAC name is (8R,8aS)-6-diethoxyphosphoryl-8-methyl-8-trimethylsilyloxy-1,2,3,6,7,8a-hexahydroindolizin-5-one.
| Compound Name | (8R,8aS)-6-diethoxyphosphoryl-8-methyl-8-trimethylsilyloxy-1,2,3,6,7,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 11111626 |
| Molecular Formula | C16H32NO5PSi |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (8R,8aS)-6-diethoxyphosphoryl-8-methyl-8-trimethylsilyloxy-1,2,3,6,7,8a-hexahydroindolizin-5-one |
| SMILES | CCOP(=O)(OCC)C1C[C@@](C)(O[Si](C)(C)C)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C16H32NO5PSi/c1-7-20-23(19,21-8-2)13-12-16(3,22-24(4,5)6)14-10-9-11-17(14)15(13)18/h13-14H,7-12H2,1-6H3/t13?,14-,16+/m0/s1 |
| InChIKey | FHXJVORTNCDRNX-JGKCFBKVSA-N |
| XLogP | 3.63 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|