C13H24NO5P — CID 10859712
[(8S,8aS)-8-methyl-5-oxo-1,2,3,6,7,8a-hexahydroindolizin-8-yl] diethyl phosphate (PubChem CID 10859712) has the molecular formula C13H24NO5P and a molecular weight of 305.31 g/mol. Its IUPAC name is [(8S,8aS)-8-methyl-5-oxo-1,2,3,6,7,8a-hexahydroindolizin-8-yl] diethyl phosphate.
| Compound Name | [(8S,8aS)-8-methyl-5-oxo-1,2,3,6,7,8a-hexahydroindolizin-8-yl] diethyl phosphate |
|---|---|
| PubChem CID | 10859712 |
| Molecular Formula | C13H24NO5P |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | [(8S,8aS)-8-methyl-5-oxo-1,2,3,6,7,8a-hexahydroindolizin-8-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O[C@@]1(C)CCC(=O)N2CCC[C@H]21 |
| InChI | InChI=1S/C13H24NO5P/c1-4-17-20(16,18-5-2)19-13(3)9-8-12(15)14-10-6-7-11(13)14/h11H,4-10H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | MENDCNZFRUEDAM-AAEUAGOBSA-N |
| XLogP | 2.73 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|