C13H24NO5P — CID 10946672
(8S,8aS)-6-diethoxyphosphoryl-8-hydroxy-8-methyl-1,2,3,6,7,8a-hexahydroindolizin-5-one (PubChem CID 10946672) has the molecular formula C13H24NO5P and a molecular weight of 305.31 g/mol. Its IUPAC name is (8S,8aS)-6-diethoxyphosphoryl-8-hydroxy-8-methyl-1,2,3,6,7,8a-hexahydroindolizin-5-one.
| Compound Name | (8S,8aS)-6-diethoxyphosphoryl-8-hydroxy-8-methyl-1,2,3,6,7,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 10946672 |
| Molecular Formula | C13H24NO5P |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (8S,8aS)-6-diethoxyphosphoryl-8-hydroxy-8-methyl-1,2,3,6,7,8a-hexahydroindolizin-5-one |
| SMILES | CCOP(=O)(OCC)C1C[C@](C)(O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C13H24NO5P/c1-4-18-20(17,19-5-2)10-9-13(3,16)11-7-6-8-14(11)12(10)15/h10-11,16H,4-9H2,1-3H3/t10?,11-,13-/m0/s1 |
| InChIKey | XFTNTLOJQBAXGF-KUNJKIHDSA-N |
| XLogP | 1.77 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|