C18H35LiNO5PSi — CID 177408818
lithium (8R)-8-[tert-butyl(dimethyl)silyl]oxy-6-diethoxyphosphoryl-1,2,3,7,8,8a-hexahydroindolizin-6-id-5-one (PubChem CID 177408818) has the molecular formula C18H35LiNO5PSi and a molecular weight of 411.48 g/mol. Its IUPAC name is lithium (8R)-8-[tert-butyl(dimethyl)silyl]oxy-6-diethoxyphosphoryl-1,2,3,7,8,8a-hexahydroindolizin-6-id-5-one.
| Compound Name | lithium (8R)-8-[tert-butyl(dimethyl)silyl]oxy-6-diethoxyphosphoryl-1,2,3,7,8,8a-hexahydroindolizin-6-id-5-one |
|---|---|
| PubChem CID | 177408818 |
| Molecular Formula | C18H35LiNO5PSi |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | lithium (8R)-8-[tert-butyl(dimethyl)silyl]oxy-6-diethoxyphosphoryl-1,2,3,7,8,8a-hexahydroindolizin-6-id-5-one |
| SMILES | CCOP(=O)(OCC)[C-]1C[C@@H](O[Si](C)(C)C(C)(C)C)C2CCCN2C1=O.[Li+] |
| InChI | InChI=1S/C18H35NO5PSi.Li/c1-8-22-25(21,23-9-2)16-13-15(24-26(6,7)18(3,4)5)14-11-10-12-19(14)17(16)20;/h14-15H,8-13H2,1-7H3;/q-1;+1/t14?,15-;/m1./s1 |
| InChIKey | YQVSALLJBKUCLC-NUNOUFIPSA-N |
| XLogP | 1.57 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|