C16H30INO2Si — CID 11037268
(3S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-3-(iodomethyl)-8a-methyl-1,2,3,6,7,8-hexahydroindolizin-5-one (PubChem CID 11037268) has the molecular formula C16H30INO2Si and a molecular weight of 423.41 g/mol. Its IUPAC name is (3S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-3-(iodomethyl)-8a-methyl-1,2,3,6,7,8-hexahydroindolizin-5-one.
| Compound Name | (3S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-3-(iodomethyl)-8a-methyl-1,2,3,6,7,8-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 11037268 |
| Molecular Formula | C16H30INO2Si |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (3S,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-3-(iodomethyl)-8a-methyl-1,2,3,6,7,8-hexahydroindolizin-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC(=O)N2[C@H](CI)CC[C@@]12C |
| InChI | InChI=1S/C16H30INO2Si/c1-15(2,3)21(5,6)20-13-7-8-14(19)18-12(11-17)9-10-16(13,18)4/h12-13H,7-11H2,1-6H3/t12-,13-,16-/m0/s1 |
| InChIKey | JHFHTJMCZHIPBR-XEZPLFJOSA-N |
| XLogP | 4.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|