C20H24BrN5O2 — CID 109461098
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[3-(3-methoxypropoxy)phenyl]-2-methylguanidine (PubChem CID 109461098) has the molecular formula C20H24BrN5O2 and a molecular weight of 446.35 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[3-(3-methoxypropoxy)phenyl]-2-methylguanidine.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[3-(3-methoxypropoxy)phenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109461098 |
| Molecular Formula | C20H24BrN5O2 |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[3-(3-methoxypropoxy)phenyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1cn2cc(Br)ccc2n1)Nc1cccc(OCCCOC)c1 |
| InChI | InChI=1S/C20H24BrN5O2/c1-22-20(23-12-17-14-26-13-15(21)7-8-19(26)24-17)25-16-5-3-6-18(11-16)28-10-4-9-27-2/h3,5-8,11,13-14H,4,9-10,12H2,1-2H3,(H2,22,23,25) |
| InChIKey | OOSDMWMACKRGKA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|