C17H27N3O2S — CID 109462408
1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-(2-prop-2-enylsulfanylethyl)guanidine (PubChem CID 109462408) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-(2-prop-2-enylsulfanylethyl)guanidine.
| Compound Name | 1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-(2-prop-2-enylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 109462408 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-[3-(3-methoxypropoxy)phenyl]-2-methyl-3-(2-prop-2-enylsulfanylethyl)guanidine |
| SMILES | C=CCSCCN/C(=N\C)Nc1cccc(OCCCOC)c1 |
| InChI | InChI=1S/C17H27N3O2S/c1-4-12-23-13-9-19-17(18-2)20-15-7-5-8-16(14-15)22-11-6-10-21-3/h4-5,7-8,14H,1,6,9-13H2,2-3H3,(H2,18,19,20) |
| InChIKey | XEGJUZMOICWIQB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|