C23H31N5O2 — CID 109462524
2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-[3-(3-methoxypropoxy)phenyl]guanidine (PubChem CID 109462524) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-[3-(3-methoxypropoxy)phenyl]guanidine.
| Compound Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-[3-(3-methoxypropoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 109462524 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-[3-(3-methoxypropoxy)phenyl]guanidine |
| SMILES | CCN/C(=N\CCCc1nc2ccccc2[nH]1)Nc1cccc(OCCCOC)c1 |
| InChI | InChI=1S/C23H31N5O2/c1-3-24-23(26-18-9-6-10-19(17-18)30-16-8-15-29-2)25-14-7-13-22-27-20-11-4-5-12-21(20)28-22/h4-6,9-12,17H,3,7-8,13-16H2,1-2H3,(H,27,28)(H2,24,25,26) |
| InChIKey | LUGWCNCOBPNFTI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|