C19H30ClN5O — CID 109462614
N-butan-2-yl-3-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]propanamide (PubChem CID 109462614) has the molecular formula C19H30ClN5O and a molecular weight of 379.94 g/mol. Its IUPAC name is N-butan-2-yl-3-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]propanamide.
| Compound Name | N-butan-2-yl-3-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 109462614 |
| Molecular Formula | C19H30ClN5O |
| Molecular Weight | 379.94 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-butan-2-yl-3-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]propanamide |
| SMILES | CCC(C)NC(=O)CCN/C(=N\C)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H30ClN5O/c1-4-14(2)23-18(26)8-10-22-19(21-3)24-16-9-11-25(13-16)17-7-5-6-15(20)12-17/h5-7,12,14,16H,4,8-11,13H2,1-3H3,(H,23,26)(H2,21,22,24) |
| InChIKey | HEMQHSFHVXUUBT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.94 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|