C20H31ClIN5O2 — CID 109462839
ethyl N-[2-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-1-cyclopropylethyl]carbamate;hydroiodide (PubChem CID 109462839) has the molecular formula C20H31ClIN5O2 and a molecular weight of 535.86 g/mol. Its IUPAC name is ethyl N-[2-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-1-cyclopropylethyl]carbamate;hydroiodide.
| Compound Name | ethyl N-[2-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-1-cyclopropylethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109462839 |
| Molecular Formula | C20H31ClIN5O2 |
| Molecular Weight | 535.86 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | ethyl N-[2-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-1-cyclopropylethyl]carbamate;hydroiodide |
| SMILES | CCOC(=O)NC(CN/C(=N\C)NC1CCN(c2cccc(Cl)c2)C1)C1CC1.I |
| InChI | InChI=1S/C20H30ClN5O2.HI/c1-3-28-20(27)25-18(14-7-8-14)12-23-19(22-2)24-16-9-10-26(13-16)17-6-4-5-15(21)11-17;/h4-6,11,14,16,18H,3,7-10,12-13H2,1-2H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | BWWQBXOMXPZCDY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.86 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|