C22H29ClIN5O2 — CID 109462887
N-[3-[2-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide (PubChem CID 109462887) has the molecular formula C22H29ClIN5O2 and a molecular weight of 557.86 g/mol. Its IUPAC name is N-[3-[2-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[2-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109462887 |
| Molecular Formula | C22H29ClIN5O2 |
| Molecular Weight | 557.86 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | N-[3-[2-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCOc1cccc(NC(C)=O)c1)NC1CCN(c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C22H28ClN5O2.HI/c1-16(29)26-18-6-4-8-21(14-18)30-12-10-25-22(24-2)27-19-9-11-28(15-19)20-7-3-5-17(23)13-20;/h3-8,13-14,19H,9-12,15H2,1-2H3,(H,26,29)(H2,24,25,27);1H |
| InChIKey | QMMYWJMTBOFYLN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.86 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|