C22H29ClIN5O2 — CID 109463385
2-[4-[2-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide (PubChem CID 109463385) has the molecular formula C22H29ClIN5O2 and a molecular weight of 557.86 g/mol. Its IUPAC name is 2-[4-[2-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[4-[2-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109463385 |
| Molecular Formula | C22H29ClIN5O2 |
| Molecular Weight | 557.86 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | 2-[4-[2-[[N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(OCC(N)=O)cc1)NC1CCN(c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C22H28ClN5O2.HI/c1-25-22(26-11-9-16-5-7-20(8-6-16)30-15-21(24)29)27-18-10-12-28(14-18)19-4-2-3-17(23)13-19;/h2-8,13,18H,9-12,14-15H2,1H3,(H2,24,29)(H2,25,26,27);1H |
| InChIKey | UDVJZSRBJDDLRO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.86 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|