C14H29FO4Si — CID 10946782
tert-butyl-[(2S,3R,4S,5S)-6-fluoro-4,5-dimethoxy-2-methyloxan-3-yl]oxy-dimethylsilane (PubChem CID 10946782) has the molecular formula C14H29FO4Si and a molecular weight of 308.47 g/mol. Its IUPAC name is tert-butyl-[(2S,3R,4S,5S)-6-fluoro-4,5-dimethoxy-2-methyloxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R,4S,5S)-6-fluoro-4,5-dimethoxy-2-methyloxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10946782 |
| Molecular Formula | C14H29FO4Si |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | tert-butyl-[(2S,3R,4S,5S)-6-fluoro-4,5-dimethoxy-2-methyloxan-3-yl]oxy-dimethylsilane |
| SMILES | CO[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)OC(F)[C@H]1OC |
| InChI | InChI=1S/C14H29FO4Si/c1-9-10(19-20(7,8)14(2,3)4)11(16-5)12(17-6)13(15)18-9/h9-13H,1-8H3/t9-,10+,11+,12-,13?/m0/s1 |
| InChIKey | UFHBKOULXBOKBX-VNXCBOPGSA-N |
| XLogP | 3.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|