C12H14F3NO3 — CID 109468392
2-(difluoromethoxy)-N-ethyl-4-fluoro-N-(2-hydroxyethyl)benzamide (PubChem CID 109468392) has the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-ethyl-4-fluoro-N-(2-hydroxyethyl)benzamide.
| Compound Name | 2-(difluoromethoxy)-N-ethyl-4-fluoro-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 109468392 |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-(difluoromethoxy)-N-ethyl-4-fluoro-N-(2-hydroxyethyl)benzamide |
| SMILES | CCN(CCO)C(=O)c1ccc(F)cc1OC(F)F |
| InChI | InChI=1S/C12H14F3NO3/c1-2-16(5-6-17)11(18)9-4-3-8(13)7-10(9)19-12(14)15/h3-4,7,12,17H,2,5-6H2,1H3 |
| InChIKey | ZKVKQJSCMIOTNB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |