C19H30N4O — CID 109468601
N-[4-[2-[[N-[(1-ethylcyclobutyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]phenyl]acetamide (PubChem CID 109468601) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is N-[4-[2-[[N-[(1-ethylcyclobutyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[[N-[(1-ethylcyclobutyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 109468601 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | N-[4-[2-[[N-[(1-ethylcyclobutyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]phenyl]acetamide |
| SMILES | CCC1(CN/C(=N\C)NCCc2ccc(NC(C)=O)cc2)CCC1 |
| InChI | InChI=1S/C19H30N4O/c1-4-19(11-5-12-19)14-22-18(20-3)21-13-10-16-6-8-17(9-7-16)23-15(2)24/h6-9H,4-5,10-14H2,1-3H3,(H,23,24)(H2,20,21,22) |
| InChIKey | LDJFVRQMYDWNDM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|