C16H27IN4O — CID 110965082
N-[4-[2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]ethyl]phenyl]acetamide;hydroiodide (PubChem CID 110965082) has the molecular formula C16H27IN4O and a molecular weight of 418.32 g/mol. Its IUPAC name is N-[4-[2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]ethyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[4-[2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]ethyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110965082 |
| Molecular Formula | C16H27IN4O |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[4-[2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]ethyl]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(NC(C)=O)cc1)NC(C)(C)C.I |
| InChI | InChI=1S/C16H26N4O.HI/c1-12(21)19-14-8-6-13(7-9-14)10-11-18-15(17-5)20-16(2,3)4;/h6-9H,10-11H2,1-5H3,(H,19,21)(H2,17,18,20);1H |
| InChIKey | IKWYRFJCUGGVSP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|