C20H35IN4O — CID 111173702
N-[4-[2-[[N'-methyl-N-(6-methylheptan-2-yl)carbamimidoyl]amino]ethyl]phenyl]acetamide;hydroiodide (PubChem CID 111173702) has the molecular formula C20H35IN4O and a molecular weight of 474.43 g/mol. Its IUPAC name is N-[4-[2-[[N'-methyl-N-(6-methylheptan-2-yl)carbamimidoyl]amino]ethyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[4-[2-[[N'-methyl-N-(6-methylheptan-2-yl)carbamimidoyl]amino]ethyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111173702 |
| Molecular Formula | C20H35IN4O |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-[4-[2-[[N'-methyl-N-(6-methylheptan-2-yl)carbamimidoyl]amino]ethyl]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(NC(C)=O)cc1)NC(C)CCCC(C)C.I |
| InChI | InChI=1S/C20H34N4O.HI/c1-15(2)7-6-8-16(3)23-20(21-5)22-14-13-18-9-11-19(12-10-18)24-17(4)25;/h9-12,15-16H,6-8,13-14H2,1-5H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | CHPXRPCXYOBNMO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|