C16H30IN3 — CID 109468901
1-[2-(cyclopenten-1-yl)ethyl]-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 109468901) has the molecular formula C16H30IN3 and a molecular weight of 391.34 g/mol. Its IUPAC name is 1-[2-(cyclopenten-1-yl)ethyl]-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(cyclopenten-1-yl)ethyl]-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109468901 |
| Molecular Formula | C16H30IN3 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 1-[2-(cyclopenten-1-yl)ethyl]-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCC1(CN/C(=N\C)NCCC2=CCCC2)CCC1.I |
| InChI | InChI=1S/C16H29N3.HI/c1-3-16(10-6-11-16)13-19-15(17-2)18-12-9-14-7-4-5-8-14;/h7H,3-6,8-13H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | HACJPRBPRNPHLC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|