C16H29N3 — CID 109468902
1-[2-(cyclopenten-1-yl)ethyl]-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine (PubChem CID 109468902) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 1-[2-(cyclopenten-1-yl)ethyl]-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(cyclopenten-1-yl)ethyl]-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109468902 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 1-[2-(cyclopenten-1-yl)ethyl]-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine |
| SMILES | CCC1(CN/C(=N\C)NCCC2=CCCC2)CCC1 |
| InChI | InChI=1S/C16H29N3/c1-3-16(10-6-11-16)13-19-15(17-2)18-12-9-14-7-4-5-8-14/h7H,3-6,8-13H2,1-2H3,(H2,17,18,19) |
| InChIKey | CQSJLXBQNBSVJD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|