C15H20F3N3O — CID 109472093
1-(3,4-dihydro-2H-chromen-4-ylmethyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472093) has the molecular formula C15H20F3N3O and a molecular weight of 315.34 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-ylmethyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-ylmethyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472093 |
| Molecular Formula | C15H20F3N3O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-ylmethyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC1CCOc2ccccc21 |
| InChI | InChI=1S/C15H20F3N3O/c1-19-14(20-8-7-15(16,17)18)21-10-11-6-9-22-13-5-3-2-4-12(11)13/h2-5,11H,6-10H2,1H3,(H2,19,20,21) |
| InChIKey | NAGUVIJGQLHSIB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|