C13H25F3N4 — CID 109472311
2-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472311) has the molecular formula C13H25F3N4 and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472311 |
| Molecular Formula | C13H25F3N4 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 2-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(/NCCC1CCN(C)CC1)NCCC(F)(F)F |
| InChI | InChI=1S/C13H25F3N4/c1-17-12(19-8-6-13(14,15)16)18-7-3-11-4-9-20(2)10-5-11/h11H,3-10H2,1-2H3,(H2,17,18,19) |
| InChIKey | CEXQOGUWQLWUNP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|