C8H14F3N5 — CID 83035532
N-(diaminomethylidene)-4-(trifluoromethyl)piperidine-1-carboximidamide (PubChem CID 83035532) has the molecular formula C8H14F3N5 and a molecular weight of 237.23 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-(trifluoromethyl)piperidine-1-carboximidamide.
| Compound Name | N-(diaminomethylidene)-4-(trifluoromethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 83035532 |
| Molecular Formula | C8H14F3N5 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-(diaminomethylidene)-4-(trifluoromethyl)piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H14F3N5/c9-8(10,11)5-1-3-16(4-2-5)7(14)15-6(12)13/h5H,1-4H2,(H5,12,13,14,15) |
| InChIKey | QVGZXHLQZIKSRE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|