C16H29F3N4O2 — CID 109472369
tert-butyl 4-[[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 109472369) has the molecular formula C16H29F3N4O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is tert-butyl 4-[[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109472369 |
| Molecular Formula | C16H29F3N4O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | tert-butyl 4-[[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H29F3N4O2/c1-15(2,3)25-14(24)23-9-5-12(6-10-23)11-22-13(20-4)21-8-7-16(17,18)19/h12H,5-11H2,1-4H3,(H2,20,21,22) |
| InChIKey | BDWMLRBSJFVCJQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|