C17H33F3IN5O2 — CID 109473120
tert-butyl 4-[3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 109473120) has the molecular formula C17H33F3IN5O2 and a molecular weight of 523.38 g/mol. Its IUPAC name is tert-butyl 4-[3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109473120 |
| Molecular Formula | C17H33F3IN5O2 |
| Molecular Weight | 523.38 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | tert-butyl 4-[3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCN(C(=O)OC(C)(C)C)CC1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C17H32F3N5O2.HI/c1-16(2,3)27-15(26)25-12-10-24(11-13-25)9-5-7-22-14(21-4)23-8-6-17(18,19)20;/h5-13H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | GPMAKNVEBPAAMS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|