C19H36O2Si — CID 10947317
[(3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dienyl] 2,2-dimethylpropanoate (PubChem CID 10947317) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is [(3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10947317 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | [(3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dienyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)=CCC/C(=C/CCOC(=O)C(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C19H36O2Si/c1-16(2)11-9-12-17(15-22(6,7)8)13-10-14-21-18(20)19(3,4)5/h11,13H,9-10,12,14-15H2,1-8H3/b17-13- |
| InChIKey | AXMRXDLURDGATP-LGMDPLHJSA-N |
| XLogP | 5.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|