C12H23F3IN5 — CID 109473310
1-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109473310) has the molecular formula C12H23F3IN5 and a molecular weight of 421.25 g/mol. Its IUPAC name is 1-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109473310 |
| Molecular Formula | C12H23F3IN5 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 1-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC1CN2CCN1CC2.I |
| InChI | InChI=1S/C12H22F3N5.HI/c1-16-11(17-3-2-12(13,14)15)18-8-10-9-19-4-6-20(10)7-5-19;/h10H,2-9H2,1H3,(H2,16,17,18);1H |
| InChIKey | RBJPAJRYLIQPIT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|