C13H25F3IN5 — CID 109473312
2-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109473312) has the molecular formula C13H25F3IN5 and a molecular weight of 435.28 g/mol. Its IUPAC name is 2-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109473312 |
| Molecular Formula | C13H25F3IN5 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 2-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CN2CCN1CC2)NCCC(F)(F)F.I |
| InChI | InChI=1S/C13H24F3N5.HI/c1-2-17-12(18-4-3-13(14,15)16)19-9-11-10-20-5-7-21(11)8-6-20;/h11H,2-10H2,1H3,(H2,17,18,19);1H |
| InChIKey | GBGPNTQZZISEPO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|