C14H20F3N5O — CID 109473511
N-(5-methyl-2-pyridinyl)-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide (PubChem CID 109473511) has the molecular formula C14H20F3N5O and a molecular weight of 331.34 g/mol. Its IUPAC name is N-(5-methyl-2-pyridinyl)-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide.
| Compound Name | N-(5-methyl-2-pyridinyl)-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 109473511 |
| Molecular Formula | C14H20F3N5O |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-(5-methyl-2-pyridinyl)-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(/NCCC(=O)Nc1ccc(C)cn1)NCCC(F)(F)F |
| InChI | InChI=1S/C14H20F3N5O/c1-10-3-4-11(21-9-10)22-12(23)5-7-19-13(18-2)20-8-6-14(15,16)17/h3-4,9H,5-8H2,1-2H3,(H2,18,19,20)(H,21,22,23) |
| InChIKey | NCHYBTRLXVKQSQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|