C21H28FN5O — CID 111625070
3-[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide (PubChem CID 111625070) has the molecular formula C21H28FN5O and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 111625070 |
| Molecular Formula | C21H28FN5O |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 3-[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
| SMILES | C/N=C(\NCCC(=O)Nc1ccc(C)cn1)NCC(C)(C)c1cccc(F)c1 |
| InChI | InChI=1S/C21H28FN5O/c1-15-8-9-18(25-13-15)27-19(28)10-11-24-20(23-4)26-14-21(2,3)16-6-5-7-17(22)12-16/h5-9,12-13H,10-11,14H2,1-4H3,(H2,23,24,26)(H,25,27,28) |
| InChIKey | LAWGJZUQPHVMQU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|