C12H24F3N3O — CID 109473769
1-ethyl-2-[2-(hydroxymethyl)-2-methylbutyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109473769) has the molecular formula C12H24F3N3O and a molecular weight of 283.34 g/mol. Its IUPAC name is 1-ethyl-2-[2-(hydroxymethyl)-2-methylbutyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(hydroxymethyl)-2-methylbutyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109473769 |
| Molecular Formula | C12H24F3N3O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-ethyl-2-[2-(hydroxymethyl)-2-methylbutyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(CC)CO)NCCC(F)(F)F |
| InChI | InChI=1S/C12H24F3N3O/c1-4-11(3,9-19)8-18-10(16-5-2)17-7-6-12(13,14)15/h19H,4-9H2,1-3H3,(H2,16,17,18) |
| InChIKey | ZCMROZJOKOBXMM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|