C12H15ClF4IN3 — CID 109474106
1-[(3-chloro-4-fluorophenyl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474106) has the molecular formula C12H15ClF4IN3 and a molecular weight of 439.62 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474106 |
| Molecular Formula | C12H15ClF4IN3 |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1ccc(F)c(Cl)c1.I |
| InChI | InChI=1S/C12H14ClF4N3.HI/c1-18-11(19-5-4-12(15,16)17)20-7-8-2-3-10(14)9(13)6-8;/h2-3,6H,4-5,7H2,1H3,(H2,18,19,20);1H |
| InChIKey | ZWGZVLVQZRCFGX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|