C15H19F3IN3O — CID 109474642
1-[2-(1-benzofuran-2-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474642) has the molecular formula C15H19F3IN3O and a molecular weight of 441.24 g/mol. Its IUPAC name is 1-[2-(1-benzofuran-2-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(1-benzofuran-2-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474642 |
| Molecular Formula | C15H19F3IN3O |
| Molecular Weight | 441.24 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 1-[2-(1-benzofuran-2-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cc2ccccc2o1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C15H18F3N3O.HI/c1-19-14(21-9-7-15(16,17)18)20-8-6-12-10-11-4-2-3-5-13(11)22-12;/h2-5,10H,6-9H2,1H3,(H2,19,20,21);1H |
| InChIKey | BOALTVISCQUQQW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|