C15H18F3N3O — CID 109474643
1-[2-(1-benzofuran-2-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109474643) has the molecular formula C15H18F3N3O and a molecular weight of 313.32 g/mol. Its IUPAC name is 1-[2-(1-benzofuran-2-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[2-(1-benzofuran-2-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109474643 |
| Molecular Formula | C15H18F3N3O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-[2-(1-benzofuran-2-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(/NCCc1cc2ccccc2o1)NCCC(F)(F)F |
| InChI | InChI=1S/C15H18F3N3O/c1-19-14(21-9-7-15(16,17)18)20-8-6-12-10-11-4-2-3-5-13(11)22-12/h2-5,10H,6-9H2,1H3,(H2,19,20,21) |
| InChIKey | VDMWPYVEMFPNMA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|