C16H31F3N4 — CID 109474831
1-ethyl-2-[4-(4-methylpiperidin-1-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109474831) has the molecular formula C16H31F3N4 and a molecular weight of 336.45 g/mol. Its IUPAC name is 1-ethyl-2-[4-(4-methylpiperidin-1-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-[4-(4-methylpiperidin-1-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109474831 |
| Molecular Formula | C16H31F3N4 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-ethyl-2-[4-(4-methylpiperidin-1-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCCCN1CCC(C)CC1)NCCC(F)(F)F |
| InChI | InChI=1S/C16H31F3N4/c1-3-20-15(22-10-8-16(17,18)19)21-9-4-5-11-23-12-6-14(2)7-13-23/h14H,3-13H2,1-2H3,(H2,20,21,22) |
| InChIKey | MUTJYHMMXCGXKF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|